C14H16N2O3S — CID 39199023
ethyl 2-(1-formyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazol-2-yl)acetate (PubChem CID 39199023) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is ethyl 2-(1-formyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazol-2-yl)acetate.
| Compound Name | ethyl 2-(1-formyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazol-2-yl)acetate |
|---|---|
| PubChem CID | 39199023 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | ethyl 2-(1-formyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazol-2-yl)acetate |
| SMILES | CCOC(=O)Cc1nc2sc3c(n2c1C=O)CCCC3 |
| InChI | InChI=1S/C14H16N2O3S/c1-2-19-13(18)7-9-11(8-17)16-10-5-3-4-6-12(10)20-14(16)15-9/h8H,2-7H2,1H3 |
| InChIKey | YPPDLPBHALFHCK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|