C18H12N2OS — CID 39199056
3-(4-phenylphenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 39199056) has the molecular formula C18H12N2OS and a molecular weight of 304.37 g/mol. Its IUPAC name is 3-(4-phenylphenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 3-(4-phenylphenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 39199056 |
| Molecular Formula | C18H12N2OS |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 3-(4-phenylphenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc2scc(-c3ccc(-c4ccccc4)cc3)n12 |
| InChI | InChI=1S/C18H12N2OS/c21-11-16-10-19-18-20(16)17(12-22-18)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-12H |
| InChIKey | ACAUNZDNEFLNAS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|