C12H5F13O3 — CID 3920204
5-fluoro-2,4-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenol (PubChem CID 3920204) has the molecular formula C12H5F13O3 and a molecular weight of 444.14 g/mol. Its IUPAC name is 5-fluoro-2,4-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenol.
| Compound Name | 5-fluoro-2,4-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenol |
|---|---|
| PubChem CID | 3920204 |
| Molecular Formula | C12H5F13O3 |
| Molecular Weight | 444.14 g/mol |
| Exact Mass | 444.00 |
| IUPAC Name | 5-fluoro-2,4-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenol |
| SMILES | Oc1cc(F)c(C(O)(C(F)(F)F)C(F)(F)F)cc1C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H5F13O3/c13-5-2-6(26)4(8(28,11(20,21)22)12(23,24)25)1-3(5)7(27,9(14,15)16)10(17,18)19/h1-2,26-28H |
| InChIKey | SRCIPCBMDVGBKL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.14 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |