About 6-(chloromethyl)-N,N-diethylpyridazin-3-amine
6-(chloromethyl)-N,N-diethylpyridazin-3-amine (PubChem CID 39203370) has the molecular formula C9H14ClN3
and a molecular weight of 199.69 g/mol. Its IUPAC name is 6-(chloromethyl)-N,N-diethylpyridazin-3-amine.
Molecular Properties
| Compound Name | 6-(chloromethyl)-N,N-diethylpyridazin-3-amine |
| PubChem CID | 39203370 |
| Molecular Formula | C9H14ClN3 |
| Molecular Weight | 199.69 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 6-(chloromethyl)-N,N-diethylpyridazin-3-amine |
| SMILES | CCN(CC)c1ccc(CCl)nn1 |
| InChI | InChI=1S/C9H14ClN3/c1-3-13(4-2)9-6-5-8(7-10)11-12-9/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | QIXHLRGMNWIITK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.69 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(chloromethyl)-N,N-diethylpyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(chloromethyl)-N,N-diethylpyridazin-3-amine?
The IUPAC name of 6-(chloromethyl)-N,N-diethylpyridazin-3-amine (CID 39203370) is 6-(chloromethyl)-N,N-diethylpyridazin-3-amine.
What is the SMILES notation for 6-(chloromethyl)-N,N-diethylpyridazin-3-amine?
The canonical SMILES for 6-(chloromethyl)-N,N-diethylpyridazin-3-amine is CCN(CC)c1ccc(CCl)nn1.
What is the InChIKey of 6-(chloromethyl)-N,N-diethylpyridazin-3-amine?
The InChIKey is QIXHLRGMNWIITK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14ClN3/c1-3-13(4-2)9-6-5-8(7-10)11-12-9/h5-6H,3-4,7H2,1-2H3.
What are the key properties of 6-(chloromethyl)-N,N-diethylpyridazin-3-amine?
6-(chloromethyl)-N,N-diethylpyridazin-3-amine has a molecular weight of 199.69 g/mol, XLogP of 2.06, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(chloromethyl)-N,N-diethylpyridazin-3-amine is sourced from PubChem (CID 39203370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).