C19H19N5O6 — CID 3921382
N-[[1-(2-bicyclo[2.2.1]heptanyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]-4-nitrobenzamide (PubChem CID 3921382) has the molecular formula C19H19N5O6 and a molecular weight of 413.39 g/mol. Its IUPAC name is N-[[1-(2-bicyclo[2.2.1]heptanyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]-4-nitrobenzamide.
| Compound Name | N-[[1-(2-bicyclo[2.2.1]heptanyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 3921382 |
| Molecular Formula | C19H19N5O6 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | N-[[1-(2-bicyclo[2.2.1]heptanyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]-4-nitrobenzamide |
| SMILES | O=C(NN=CC1C(=O)NC(=O)N(C2CC3CCC2C3)C1=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H19N5O6/c25-16(11-3-5-13(6-4-11)24(29)30)22-20-9-14-17(26)21-19(28)23(18(14)27)15-8-10-1-2-12(15)7-10/h3-6,9-10,12,14-15H,1-2,7-8H2,(H,22,25)(H,21,26,28) |
| InChIKey | CVIZAODZMOXIHL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 151.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|