C24H21N5O3 — CID 3921673
propan-2-yl 4-[2-[(4-cyano-3-methyl-1-oxopyrido[1,2-a]benzimidazol-2-ylidene)methyl]hydrazinyl]benzoate (PubChem CID 3921673) has the molecular formula C24H21N5O3 and a molecular weight of 427.46 g/mol. Its IUPAC name is propan-2-yl 4-[2-[(4-cyano-3-methyl-1-oxopyrido[1,2-a]benzimidazol-2-ylidene)methyl]hydrazinyl]benzoate.
| Compound Name | propan-2-yl 4-[2-[(4-cyano-3-methyl-1-oxopyrido[1,2-a]benzimidazol-2-ylidene)methyl]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 3921673 |
| Molecular Formula | C24H21N5O3 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | propan-2-yl 4-[2-[(4-cyano-3-methyl-1-oxopyrido[1,2-a]benzimidazol-2-ylidene)methyl]hydrazinyl]benzoate |
| SMILES | Cc1c(C#N)c2nc3ccccc3n2c(=O)c1=CNNc1ccc(C(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C24H21N5O3/c1-14(2)32-24(31)16-8-10-17(11-9-16)28-26-13-19-15(3)18(12-25)22-27-20-6-4-5-7-21(20)29(22)23(19)30/h4-11,13-14,26,28H,1-3H3 |
| InChIKey | AETQLMNSTCWVRA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|