About 3-(3,4-dimethoxyphenyl)phenol
3-(3,4-dimethoxyphenyl)phenol (PubChem CID 39231875) has the molecular formula C14H14O3
and a molecular weight of 230.26 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)phenol.
Molecular Properties
| Compound Name | 3-(3,4-dimethoxyphenyl)phenol |
| PubChem CID | 39231875 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)phenol |
| SMILES | COc1ccc(-c2cccc(O)c2)cc1OC |
| InChI | InChI=1S/C14H14O3/c1-16-13-7-6-11(9-14(13)17-2)10-4-3-5-12(15)8-10/h3-9,15H,1-2H3 |
| InChIKey | RFVVIXRPCYFXJJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,4-dimethoxyphenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethoxyphenyl)phenol?
The IUPAC name of 3-(3,4-dimethoxyphenyl)phenol (CID 39231875) is 3-(3,4-dimethoxyphenyl)phenol.
What is the SMILES notation for 3-(3,4-dimethoxyphenyl)phenol?
The canonical SMILES for 3-(3,4-dimethoxyphenyl)phenol is COc1ccc(-c2cccc(O)c2)cc1OC.
What is the InChIKey of 3-(3,4-dimethoxyphenyl)phenol?
The InChIKey is RFVVIXRPCYFXJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O3/c1-16-13-7-6-11(9-14(13)17-2)10-4-3-5-12(15)8-10/h3-9,15H,1-2H3.
What are the key properties of 3-(3,4-dimethoxyphenyl)phenol?
3-(3,4-dimethoxyphenyl)phenol has a molecular weight of 230.26 g/mol, XLogP of 3.08, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethoxyphenyl)phenol is sourced from PubChem (CID 39231875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).