About 6-(2,5-dichlorophenyl)-2,3,4-trimethoxybenzaldehyde
6-(2,5-dichlorophenyl)-2,3,4-trimethoxybenzaldehyde (PubChem CID 39234327) has the molecular formula C16H14Cl2O4
and a molecular weight of 341.19 g/mol. Its IUPAC name is 6-(2,5-dichlorophenyl)-2,3,4-trimethoxybenzaldehyde.
Molecular Properties
| Compound Name | 6-(2,5-dichlorophenyl)-2,3,4-trimethoxybenzaldehyde |
| PubChem CID | 39234327 |
| Molecular Formula | C16H14Cl2O4 |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 6-(2,5-dichlorophenyl)-2,3,4-trimethoxybenzaldehyde |
| SMILES | COc1cc(-c2cc(Cl)ccc2Cl)c(C=O)c(OC)c1OC |
| InChI | InChI=1S/C16H14Cl2O4/c1-20-14-7-10(11-6-9(17)4-5-13(11)18)12(8-19)15(21-2)16(14)22-3/h4-8H,1-3H3 |
| InChIKey | VTQCYHPAARIZFT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,5-dichlorophenyl)-2,3,4-trimethoxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,5-dichlorophenyl)-2,3,4-trimethoxybenzaldehyde?
The IUPAC name of 6-(2,5-dichlorophenyl)-2,3,4-trimethoxybenzaldehyde (CID 39234327) is 6-(2,5-dichlorophenyl)-2,3,4-trimethoxybenzaldehyde.
What is the SMILES notation for 6-(2,5-dichlorophenyl)-2,3,4-trimethoxybenzaldehyde?
The canonical SMILES for 6-(2,5-dichlorophenyl)-2,3,4-trimethoxybenzaldehyde is COc1cc(-c2cc(Cl)ccc2Cl)c(C=O)c(OC)c1OC.
What is the InChIKey of 6-(2,5-dichlorophenyl)-2,3,4-trimethoxybenzaldehyde?
The InChIKey is VTQCYHPAARIZFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Cl2O4/c1-20-14-7-10(11-6-9(17)4-5-13(11)18)12(8-19)15(21-2)16(14)22-3/h4-8H,1-3H3.
What are the key properties of 6-(2,5-dichlorophenyl)-2,3,4-trimethoxybenzaldehyde?
6-(2,5-dichlorophenyl)-2,3,4-trimethoxybenzaldehyde has a molecular weight of 341.19 g/mol, XLogP of 4.50, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,5-dichlorophenyl)-2,3,4-trimethoxybenzaldehyde is sourced from PubChem (CID 39234327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).