About Daimuron
Daimuron (PubChem CID 39238) has the molecular formula C17H20N2O
and a molecular weight of 268.35 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-(2-phenylpropan-2-yl)urea.
Molecular Properties
| Compound Name | Daimuron |
| PubChem CID | 39238 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 1-(4-methylphenyl)-3-(2-phenylpropan-2-yl)urea |
| SMILES | CC1=CC=C(C=C1)NC(=O)NC(C)(C)C2=CC=CC=C2 |
| InChI | InChI=1S/C17H20N2O/c1-13-9-11-15(12-10-13)18-16(20)19-17(2,3)14-7-5-4-6-8-14/h4-12H,1-3H3,(H2,18,19,20) |
| InChIKey | NNYRZQHKCHEXSD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | 313 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Daimuron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Daimuron?
The IUPAC name of Daimuron (CID 39238) is 1-(4-methylphenyl)-3-(2-phenylpropan-2-yl)urea.
What is the SMILES notation for Daimuron?
The canonical SMILES for Daimuron is CC1=CC=C(C=C1)NC(=O)NC(C)(C)C2=CC=CC=C2.
What is the InChIKey of Daimuron?
The InChIKey is NNYRZQHKCHEXSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O/c1-13-9-11-15(12-10-13)18-16(20)19-17(2,3)14-7-5-4-6-8-14/h4-12H,1-3H3,(H2,18,19,20).
What are the key properties of Daimuron?
Daimuron has a molecular weight of 268.35 g/mol, XLogP of 3.40, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Daimuron is sourced from PubChem (CID 39238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).