About 2-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]amino]-3-phenylpropanoic acid
2-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]amino]-3-phenylpropanoic acid (PubChem CID 3924701) has the molecular formula C18H15ClN2O3
and a molecular weight of 342.78 g/mol. Its IUPAC name is 2-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]amino]-3-phenylpropanoic acid.
Molecular Properties
| Compound Name | 2-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]amino]-3-phenylpropanoic acid |
| PubChem CID | 3924701 |
| Molecular Formula | C18H15ClN2O3 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)Nc1cc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C18H15ClN2O3/c19-14-8-6-13(7-9-14)15-11-17(24-21-15)20-16(18(22)23)10-12-4-2-1-3-5-12/h1-9,11,16,20H,10H2,(H,22,23) |
| InChIKey | PWSLUBYNZQSQGQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]amino]-3-phenylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]amino]-3-phenylpropanoic acid?
The IUPAC name of 2-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]amino]-3-phenylpropanoic acid (CID 3924701) is 2-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]amino]-3-phenylpropanoic acid.
What is the SMILES notation for 2-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]amino]-3-phenylpropanoic acid?
The canonical SMILES for 2-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]amino]-3-phenylpropanoic acid is O=C(O)C(Cc1ccccc1)Nc1cc(-c2ccc(Cl)cc2)no1.
What is the InChIKey of 2-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]amino]-3-phenylpropanoic acid?
The InChIKey is PWSLUBYNZQSQGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15ClN2O3/c19-14-8-6-13(7-9-14)15-11-17(24-21-15)20-16(18(22)23)10-12-4-2-1-3-5-12/h1-9,11,16,20H,10H2,(H,22,23).
What are the key properties of 2-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]amino]-3-phenylpropanoic acid?
2-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]amino]-3-phenylpropanoic acid has a molecular weight of 342.78 g/mol, XLogP of 4.10, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]amino]-3-phenylpropanoic acid is sourced from PubChem (CID 3924701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).