C14H19N3 — CID 39247652
3,5-dimethyl-1-(2,4,6-trimethylphenyl)pyrazol-4-amine (PubChem CID 39247652) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 3,5-dimethyl-1-(2,4,6-trimethylphenyl)pyrazol-4-amine.
| Compound Name | 3,5-dimethyl-1-(2,4,6-trimethylphenyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 39247652 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 3,5-dimethyl-1-(2,4,6-trimethylphenyl)pyrazol-4-amine |
| SMILES | Cc1cc(C)c(-n2nc(C)c(N)c2C)c(C)c1 |
| InChI | InChI=1S/C14H19N3/c1-8-6-9(2)14(10(3)7-8)17-12(5)13(15)11(4)16-17/h6-7H,15H2,1-5H3 |
| InChIKey | PVCQXOTUAIWZGZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |