C20H25BrN4 — CID 3925373
6-bromo-2-pyridin-2-yl-N-(2,4,4-trimethylpentan-2-yl)imidazo[1,2-a]pyridin-3-amine (PubChem CID 3925373) has the molecular formula C20H25BrN4 and a molecular weight of 401.35 g/mol. Its IUPAC name is 6-bromo-2-pyridin-2-yl-N-(2,4,4-trimethylpentan-2-yl)imidazo[1,2-a]pyridin-3-amine.
| Compound Name | 6-bromo-2-pyridin-2-yl-N-(2,4,4-trimethylpentan-2-yl)imidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 3925373 |
| Molecular Formula | C20H25BrN4 |
| Molecular Weight | 401.35 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 6-bromo-2-pyridin-2-yl-N-(2,4,4-trimethylpentan-2-yl)imidazo[1,2-a]pyridin-3-amine |
| SMILES | CC(C)(C)CC(C)(C)Nc1c(-c2ccccn2)nc2ccc(Br)cn12 |
| InChI | InChI=1S/C20H25BrN4/c1-19(2,3)13-20(4,5)24-18-17(15-8-6-7-11-22-15)23-16-10-9-14(21)12-25(16)18/h6-12,24H,13H2,1-5H3 |
| InChIKey | RONFABYJEAFKMM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.35 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_Db(5)', 'substructure': 'N/A'} |
|---|