About ethyl 2-amino-2,2-diphenylacetate
ethyl 2-amino-2,2-diphenylacetate (PubChem CID 3925429) has the molecular formula C16H17NO2
and a molecular weight of 255.32 g/mol. Its IUPAC name is ethyl 2-amino-2,2-diphenylacetate.
Molecular Properties
| Compound Name | ethyl 2-amino-2,2-diphenylacetate |
| PubChem CID | 3925429 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | ethyl 2-amino-2,2-diphenylacetate |
| SMILES | CCOC(=O)C(N)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17NO2/c1-2-19-15(18)16(17,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,2,17H2,1H3 |
| InChIKey | KGGXOKUIZXYLML-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-amino-2,2-diphenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-amino-2,2-diphenylacetate?
The IUPAC name of ethyl 2-amino-2,2-diphenylacetate (CID 3925429) is ethyl 2-amino-2,2-diphenylacetate.
What is the SMILES notation for ethyl 2-amino-2,2-diphenylacetate?
The canonical SMILES for ethyl 2-amino-2,2-diphenylacetate is CCOC(=O)C(N)(c1ccccc1)c1ccccc1.
What is the InChIKey of ethyl 2-amino-2,2-diphenylacetate?
The InChIKey is KGGXOKUIZXYLML-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO2/c1-2-19-15(18)16(17,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,2,17H2,1H3.
What are the key properties of ethyl 2-amino-2,2-diphenylacetate?
ethyl 2-amino-2,2-diphenylacetate has a molecular weight of 255.32 g/mol, XLogP of 2.45, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-amino-2,2-diphenylacetate is sourced from PubChem (CID 3925429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).