C26H30FN3O5 — CID 3925734
2-methoxyethyl 3-butyl-6-[3-[(2-fluorobenzoyl)amino]phenyl]-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 3925734) has the molecular formula C26H30FN3O5 and a molecular weight of 483.54 g/mol. Its IUPAC name is 2-methoxyethyl 3-butyl-6-[3-[(2-fluorobenzoyl)amino]phenyl]-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | 2-methoxyethyl 3-butyl-6-[3-[(2-fluorobenzoyl)amino]phenyl]-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 3925734 |
| Molecular Formula | C26H30FN3O5 |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 2-methoxyethyl 3-butyl-6-[3-[(2-fluorobenzoyl)amino]phenyl]-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCCCN1C(=O)NC(c2cccc(NC(=O)c3ccccc3F)c2)C(C(=O)OCCOC)=C1C |
| InChI | InChI=1S/C26H30FN3O5/c1-4-5-13-30-17(2)22(25(32)35-15-14-34-3)23(29-26(30)33)18-9-8-10-19(16-18)28-24(31)20-11-6-7-12-21(20)27/h6-12,16,23H,4-5,13-15H2,1-3H3,(H,28,31)(H,29,33) |
| InChIKey | SXRCTVKPCZLSIK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|