C16H25NO2 — CID 3925935
1-benzyl-4,4-diethoxypiperidine (PubChem CID 3925935) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 1-benzyl-4,4-diethoxypiperidine.
| Compound Name | 1-benzyl-4,4-diethoxypiperidine |
|---|---|
| PubChem CID | 3925935 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 1-benzyl-4,4-diethoxypiperidine |
| SMILES | CCOC1(OCC)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C16H25NO2/c1-3-18-16(19-4-2)10-12-17(13-11-16)14-15-8-6-5-7-9-15/h5-9H,3-4,10-14H2,1-2H3 |
| InChIKey | BIWIVGCTGYSXRF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|