C16H11ClIN3O2S — CID 3926264
2-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(2-iodophenyl)acetamide (PubChem CID 3926264) has the molecular formula C16H11ClIN3O2S and a molecular weight of 471.71 g/mol. Its IUPAC name is 2-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(2-iodophenyl)acetamide.
| Compound Name | 2-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(2-iodophenyl)acetamide |
|---|---|
| PubChem CID | 3926264 |
| Molecular Formula | C16H11ClIN3O2S |
| Molecular Weight | 471.71 g/mol |
| Exact Mass | 470.93 |
| IUPAC Name | 2-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(2-iodophenyl)acetamide |
| SMILES | O=C(CSc1nnc(-c2cccc(Cl)c2)o1)Nc1ccccc1I |
| InChI | InChI=1S/C16H11ClIN3O2S/c17-11-5-3-4-10(8-11)15-20-21-16(23-15)24-9-14(22)19-13-7-2-1-6-12(13)18/h1-8H,9H2,(H,19,22) |
| InChIKey | BUUAXQSTATXZLW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.71 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|