C13H8F4O2 — CID 3926875
3,4,5,6-tetrafluoro-8-methoxytricyclo[6.2.2.02,7]dodeca-2(7),3,5,11-tetraen-9-one (PubChem CID 3926875) has the molecular formula C13H8F4O2 and a molecular weight of 272.20 g/mol. Its IUPAC name is 3,4,5,6-tetrafluoro-8-methoxytricyclo[6.2.2.02,7]dodeca-2(7),3,5,11-tetraen-9-one.
| Compound Name | 3,4,5,6-tetrafluoro-8-methoxytricyclo[6.2.2.02,7]dodeca-2(7),3,5,11-tetraen-9-one |
|---|---|
| PubChem CID | 3926875 |
| Molecular Formula | C13H8F4O2 |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 3,4,5,6-tetrafluoro-8-methoxytricyclo[6.2.2.02,7]dodeca-2(7),3,5,11-tetraen-9-one |
| SMILES | COC12C=CC(CC1=O)c1c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C13H8F4O2/c1-19-13-3-2-5(4-6(13)18)7-8(13)10(15)12(17)11(16)9(7)14/h2-3,5H,4H2,1H3 |
| InChIKey | HTGDEGJCHPJUJS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|