C11H12Cl3NOS — CID 39271937
(1R)-2,2-dichloro-N-[(1S)-1-(5-chlorothiophen-2-yl)ethyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 39271937) has the molecular formula C11H12Cl3NOS and a molecular weight of 312.65 g/mol. Its IUPAC name is (1R)-2,2-dichloro-N-[(1S)-1-(5-chlorothiophen-2-yl)ethyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | (1R)-2,2-dichloro-N-[(1S)-1-(5-chlorothiophen-2-yl)ethyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 39271937 |
| Molecular Formula | C11H12Cl3NOS |
| Molecular Weight | 312.65 g/mol |
| Exact Mass | 310.97 |
| IUPAC Name | (1R)-2,2-dichloro-N-[(1S)-1-(5-chlorothiophen-2-yl)ethyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | C[C@H](NC(=O)[C@@]1(C)CC1(Cl)Cl)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H12Cl3NOS/c1-6(7-3-4-8(12)17-7)15-9(16)10(2)5-11(10,13)14/h3-4,6H,5H2,1-2H3,(H,15,16)/t6-,10+/m0/s1 |
| InChIKey | AXYSDGLHTLZLQI-QUBYGPBYSA-N |
| XLogP | 4.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.65 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|