C26H28N2O4S2 — CID 3927829
2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-6-ethyl-3-(3-methoxyphenyl)-5-methylthieno[2,3-d]pyrimidin-4-one (PubChem CID 3927829) has the molecular formula C26H28N2O4S2 and a molecular weight of 496.65 g/mol. Its IUPAC name is 2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-6-ethyl-3-(3-methoxyphenyl)-5-methylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-6-ethyl-3-(3-methoxyphenyl)-5-methylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3927829 |
| Molecular Formula | C26H28N2O4S2 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-6-ethyl-3-(3-methoxyphenyl)-5-methylthieno[2,3-d]pyrimidin-4-one |
| SMILES | CCOc1ccc(OCCSc2nc3sc(CC)c(C)c3c(=O)n2-c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C26H28N2O4S2/c1-5-22-17(3)23-24(34-22)27-26(28(25(23)29)18-8-7-9-21(16-18)30-4)33-15-14-32-20-12-10-19(11-13-20)31-6-2/h7-13,16H,5-6,14-15H2,1-4H3 |
| InChIKey | ZHCWYBWXUMSWGP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|