C26H20N2+2 — CID 3927921
7,12-diphenyl-1,4-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,9,11,13-heptaene (PubChem CID 3927921) has the molecular formula C26H20N2+2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 7,12-diphenyl-1,4-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,9,11,13-heptaene.
| Compound Name | 7,12-diphenyl-1,4-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,9,11,13-heptaene |
|---|---|
| PubChem CID | 3927921 |
| Molecular Formula | C26H20N2+2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 7,12-diphenyl-1,4-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,9,11,13-heptaene |
| SMILES | c1ccc(-c2cc[n+]3c4c2ccc2c(-c5ccccc5)cc[n+](c24)CC3)cc1 |
| InChI | InChI=1S/C26H20N2/c1-3-7-19(8-4-1)21-13-15-27-17-18-28-16-14-22(20-9-5-2-6-10-20)24-12-11-23(21)25(27)26(24)28/h1-16H,17-18H2/q+2 |
| InChIKey | OZAPLKDXSLVXDE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|