About N-methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine
N-methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine (PubChem CID 3928654) has the molecular formula C6H10N2S
and a molecular weight of 142.23 g/mol. Its IUPAC name is N-methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine.
Molecular Properties
| Compound Name | N-methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine |
| PubChem CID | 3928654 |
| Molecular Formula | C6H10N2S |
| Molecular Weight | 142.23 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | N-methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine |
| SMILES | CNCc1nc(C)cs1 |
| InChI | InChI=1S/C6H10N2S/c1-5-4-9-6(8-5)3-7-2/h4,7H,3H2,1-2H3 |
| InChIKey | KMGBNXQVTATQAD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.23 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine?
The IUPAC name of N-methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine (CID 3928654) is N-methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine.
What is the SMILES notation for N-methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine?
The canonical SMILES for N-methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine is CNCc1nc(C)cs1.
What is the InChIKey of N-methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine?
The InChIKey is KMGBNXQVTATQAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2S/c1-5-4-9-6(8-5)3-7-2/h4,7H,3H2,1-2H3.
What are the key properties of N-methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine?
N-methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine has a molecular weight of 142.23 g/mol, XLogP of 1.17, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(4-methyl-1,3-thiazol-2-yl)methanamine is sourced from PubChem (CID 3928654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).