C18H20N4O2 — CID 3928959
4-oxo-N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]-3H-phthalazine-1-carboxamide (PubChem CID 3928959) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 4-oxo-N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]-3H-phthalazine-1-carboxamide.
| Compound Name | 4-oxo-N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 3928959 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 4-oxo-N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]-3H-phthalazine-1-carboxamide |
| SMILES | CC1=CC(=NNC(=O)c2n[nH]c(=O)c3ccccc23)CC(C)(C)C1 |
| InChI | InChI=1S/C18H20N4O2/c1-11-8-12(10-18(2,3)9-11)19-22-17(24)15-13-6-4-5-7-14(13)16(23)21-20-15/h4-8H,9-10H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | DNESHZXHMWNJPP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|