C31H24F6N4O2 — CID 3929391
5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 3929391) has the molecular formula C31H24F6N4O2 and a molecular weight of 598.55 g/mol. Its IUPAC name is 5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 3929391 |
| Molecular Formula | C31H24F6N4O2 |
| Molecular Weight | 598.55 g/mol |
| Exact Mass | 598.18 |
| IUPAC Name | 5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCc3ccccc3C2)c(C(=O)NCc2cccnc2)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H24F6N4O2/c32-30(33,34)23-12-22(13-24(14-23)31(35,36)37)28(42)40-25-7-8-27(41-11-9-20-5-1-2-6-21(20)18-41)26(15-25)29(43)39-17-19-4-3-10-38-16-19/h1-8,10,12-16H,9,11,17-18H2,(H,39,43)(H,40,42) |
| InChIKey | KCFYOZQMACUXQD-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.55 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|