C18H19N7O3 — CID 39296720
N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-5-ethyl-1-(4-nitrophenyl)pyrazole-4-carboxamide (PubChem CID 39296720) has the molecular formula C18H19N7O3 and a molecular weight of 381.40 g/mol. Its IUPAC name is N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-5-ethyl-1-(4-nitrophenyl)pyrazole-4-carboxamide.
| Compound Name | N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-5-ethyl-1-(4-nitrophenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 39296720 |
| Molecular Formula | C18H19N7O3 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-5-ethyl-1-(4-nitrophenyl)pyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)NCc2nnc3n2CCC3)cnn1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H19N7O3/c1-2-15-14(10-20-24(15)12-5-7-13(8-6-12)25(27)28)18(26)19-11-17-22-21-16-4-3-9-23(16)17/h5-8,10H,2-4,9,11H2,1H3,(H,19,26) |
| InChIKey | UYBAIXVLBOKDMO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|