About octadeca-9,12-dienamide
octadeca-9,12-dienamide (PubChem CID 3930) has the molecular formula C18H33NO
and a molecular weight of 279.47 g/mol. Its IUPAC name is octadeca-9,12-dienamide.
Molecular Properties
| Compound Name | octadeca-9,12-dienamide |
| PubChem CID | 3930 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | octadeca-9,12-dienamide |
| SMILES | CCCCCC=CCC=CCCCCCCCC(N)=O |
| InChI | InChI=1S/C18H33NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10H,2-5,8,11-17H2,1H3,(H2,19,20) |
| InChIKey | SFIHQZFZMWZOJV-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze octadeca-9,12-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadeca-9,12-dienamide?
The IUPAC name of octadeca-9,12-dienamide (CID 3930) is octadeca-9,12-dienamide.
What is the SMILES notation for octadeca-9,12-dienamide?
The canonical SMILES for octadeca-9,12-dienamide is CCCCCC=CCC=CCCCCCCCC(N)=O.
What is the InChIKey of octadeca-9,12-dienamide?
The InChIKey is SFIHQZFZMWZOJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10H,2-5,8,11-17H2,1H3,(H2,19,20).
What are the key properties of octadeca-9,12-dienamide?
octadeca-9,12-dienamide has a molecular weight of 279.47 g/mol, XLogP of 5.29, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octadeca-9,12-dienamide is sourced from PubChem (CID 3930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).