About N-tert-butyl-3-(3,3-dimethylbutanoyl)-1,3-thiazolidine-4-carboxamide
N-tert-butyl-3-(3,3-dimethylbutanoyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 3930149) has the molecular formula C14H26N2O2S
and a molecular weight of 286.44 g/mol. Its IUPAC name is N-tert-butyl-3-(3,3-dimethylbutanoyl)-1,3-thiazolidine-4-carboxamide.
Molecular Properties
| Compound Name | N-tert-butyl-3-(3,3-dimethylbutanoyl)-1,3-thiazolidine-4-carboxamide |
| PubChem CID | 3930149 |
| Molecular Formula | C14H26N2O2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | N-tert-butyl-3-(3,3-dimethylbutanoyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CC(C)(C)CC(=O)N1CSCC1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H26N2O2S/c1-13(2,3)7-11(17)16-9-19-8-10(16)12(18)15-14(4,5)6/h10H,7-9H2,1-6H3,(H,15,18) |
| InChIKey | WZLNEEUYBVSTMD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-3-(3,3-dimethylbutanoyl)-1,3-thiazolidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-3-(3,3-dimethylbutanoyl)-1,3-thiazolidine-4-carboxamide?
The IUPAC name of N-tert-butyl-3-(3,3-dimethylbutanoyl)-1,3-thiazolidine-4-carboxamide (CID 3930149) is N-tert-butyl-3-(3,3-dimethylbutanoyl)-1,3-thiazolidine-4-carboxamide.
What is the SMILES notation for N-tert-butyl-3-(3,3-dimethylbutanoyl)-1,3-thiazolidine-4-carboxamide?
The canonical SMILES for N-tert-butyl-3-(3,3-dimethylbutanoyl)-1,3-thiazolidine-4-carboxamide is CC(C)(C)CC(=O)N1CSCC1C(=O)NC(C)(C)C.
What is the InChIKey of N-tert-butyl-3-(3,3-dimethylbutanoyl)-1,3-thiazolidine-4-carboxamide?
The InChIKey is WZLNEEUYBVSTMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O2S/c1-13(2,3)7-11(17)16-9-19-8-10(16)12(18)15-14(4,5)6/h10H,7-9H2,1-6H3,(H,15,18).
What are the key properties of N-tert-butyl-3-(3,3-dimethylbutanoyl)-1,3-thiazolidine-4-carboxamide?
N-tert-butyl-3-(3,3-dimethylbutanoyl)-1,3-thiazolidine-4-carboxamide has a molecular weight of 286.44 g/mol, XLogP of 2.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-3-(3,3-dimethylbutanoyl)-1,3-thiazolidine-4-carboxamide is sourced from PubChem (CID 3930149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).