C27H32N4O3S — CID 3930361
1-[[2-[1,2-bis(4-methoxyphenyl)butylamino]acetyl]amino]-3-phenylthiourea (PubChem CID 3930361) has the molecular formula C27H32N4O3S and a molecular weight of 492.65 g/mol. Its IUPAC name is 1-[[2-[1,2-bis(4-methoxyphenyl)butylamino]acetyl]amino]-3-phenylthiourea.
| Compound Name | 1-[[2-[1,2-bis(4-methoxyphenyl)butylamino]acetyl]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 3930361 |
| Molecular Formula | C27H32N4O3S |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 1-[[2-[1,2-bis(4-methoxyphenyl)butylamino]acetyl]amino]-3-phenylthiourea |
| SMILES | CCC(c1ccc(OC)cc1)C(NCC(=O)NNC(=S)Nc1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H32N4O3S/c1-4-24(19-10-14-22(33-2)15-11-19)26(20-12-16-23(34-3)17-13-20)28-18-25(32)30-31-27(35)29-21-8-6-5-7-9-21/h5-17,24,26,28H,4,18H2,1-3H3,(H,30,32)(H2,29,31,35) |
| InChIKey | SUEUSGYVMZJYBO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 83.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|