About 2-(1,3-benzodioxol-5-yloxymethyl)-5-(4-methoxyanilino)-1,3-oxazole-4-carbonitrile
2-(1,3-benzodioxol-5-yloxymethyl)-5-(4-methoxyanilino)-1,3-oxazole-4-carbonitrile (PubChem CID 39308513) has the molecular formula C19H15N3O5
and a molecular weight of 365.35 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxymethyl)-5-(4-methoxyanilino)-1,3-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 2-(1,3-benzodioxol-5-yloxymethyl)-5-(4-methoxyanilino)-1,3-oxazole-4-carbonitrile |
| PubChem CID | 39308513 |
| Molecular Formula | C19H15N3O5 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxymethyl)-5-(4-methoxyanilino)-1,3-oxazole-4-carbonitrile |
| SMILES | COc1ccc(Nc2oc(COc3ccc4c(c3)OCO4)nc2C#N)cc1 |
| InChI | InChI=1S/C19H15N3O5/c1-23-13-4-2-12(3-5-13)21-19-15(9-20)22-18(27-19)10-24-14-6-7-16-17(8-14)26-11-25-16/h2-8,21H,10-11H2,1H3 |
| InChIKey | RACOBACLAKEDMO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-(1,3-benzodioxol-5-yloxymethyl)-5-(4-methoxyanilino)-1,3-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzodioxol-5-yloxymethyl)-5-(4-methoxyanilino)-1,3-oxazole-4-carbonitrile?
The IUPAC name of 2-(1,3-benzodioxol-5-yloxymethyl)-5-(4-methoxyanilino)-1,3-oxazole-4-carbonitrile (CID 39308513) is 2-(1,3-benzodioxol-5-yloxymethyl)-5-(4-methoxyanilino)-1,3-oxazole-4-carbonitrile.
What is the SMILES notation for 2-(1,3-benzodioxol-5-yloxymethyl)-5-(4-methoxyanilino)-1,3-oxazole-4-carbonitrile?
The canonical SMILES for 2-(1,3-benzodioxol-5-yloxymethyl)-5-(4-methoxyanilino)-1,3-oxazole-4-carbonitrile is COc1ccc(Nc2oc(COc3ccc4c(c3)OCO4)nc2C#N)cc1.
What is the InChIKey of 2-(1,3-benzodioxol-5-yloxymethyl)-5-(4-methoxyanilino)-1,3-oxazole-4-carbonitrile?
The InChIKey is RACOBACLAKEDMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O5/c1-23-13-4-2-12(3-5-13)21-19-15(9-20)22-18(27-19)10-24-14-6-7-16-17(8-14)26-11-25-16/h2-8,21H,10-11H2,1H3.
What are the key properties of 2-(1,3-benzodioxol-5-yloxymethyl)-5-(4-methoxyanilino)-1,3-oxazole-4-carbonitrile?
2-(1,3-benzodioxol-5-yloxymethyl)-5-(4-methoxyanilino)-1,3-oxazole-4-carbonitrile has a molecular weight of 365.35 g/mol, XLogP of 3.61, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzodioxol-5-yloxymethyl)-5-(4-methoxyanilino)-1,3-oxazole-4-carbonitrile is sourced from PubChem (CID 39308513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).