C24H22N4OS — CID 39310732
4-benzyl-11,12-dimethyl-8-(2-phenylethyl)-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one (PubChem CID 39310732) has the molecular formula C24H22N4OS and a molecular weight of 414.53 g/mol. Its IUPAC name is 4-benzyl-11,12-dimethyl-8-(2-phenylethyl)-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one.
| Compound Name | 4-benzyl-11,12-dimethyl-8-(2-phenylethyl)-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one |
|---|---|
| PubChem CID | 39310732 |
| Molecular Formula | C24H22N4OS |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 4-benzyl-11,12-dimethyl-8-(2-phenylethyl)-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one |
| SMILES | Cc1sc2c(c1C)c1nc(Cc3ccccc3)nn1c(=O)n2CCc1ccccc1 |
| InChI | InChI=1S/C24H22N4OS/c1-16-17(2)30-23-21(16)22-25-20(15-19-11-7-4-8-12-19)26-28(22)24(29)27(23)14-13-18-9-5-3-6-10-18/h3-12H,13-15H2,1-2H3 |
| InChIKey | ZVCFOWMEMWYYAU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |