C18H19N3O6S — CID 39313837
(3R)-N-[4-(acetylsulfamoyl)phenyl]-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 39313837) has the molecular formula C18H19N3O6S and a molecular weight of 405.43 g/mol. Its IUPAC name is (3R)-N-[4-(acetylsulfamoyl)phenyl]-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[4-(acetylsulfamoyl)phenyl]-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 39313837 |
| Molecular Formula | C18H19N3O6S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | (3R)-N-[4-(acetylsulfamoyl)phenyl]-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NC(=O)[C@@H]2CC(=O)N(Cc3ccco3)C2)cc1 |
| InChI | InChI=1S/C18H19N3O6S/c1-12(22)20-28(25,26)16-6-4-14(5-7-16)19-18(24)13-9-17(23)21(10-13)11-15-3-2-8-27-15/h2-8,13H,9-11H2,1H3,(H,19,24)(H,20,22)/t13-/m1/s1 |
| InChIKey | RXXYJNPYNYYABX-CYBMUJFWSA-N |
| XLogP | 1.09 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |