C15H17N3O3S — CID 3931664
4-(3,4,5-trimethoxyphenyl)-3,5,6,7-tetrahydropyrrolo[2,3-d]pyrimidine-2-thione (PubChem CID 3931664) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 4-(3,4,5-trimethoxyphenyl)-3,5,6,7-tetrahydropyrrolo[2,3-d]pyrimidine-2-thione.
| Compound Name | 4-(3,4,5-trimethoxyphenyl)-3,5,6,7-tetrahydropyrrolo[2,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 3931664 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 4-(3,4,5-trimethoxyphenyl)-3,5,6,7-tetrahydropyrrolo[2,3-d]pyrimidine-2-thione |
| SMILES | COc1cc(-c2[nH]c(=S)nc3c2CCN3)cc(OC)c1OC |
| InChI | InChI=1S/C15H17N3O3S/c1-19-10-6-8(7-11(20-2)13(10)21-3)12-9-4-5-16-14(9)18-15(22)17-12/h6-7H,4-5H2,1-3H3,(H2,16,17,18,22) |
| InChIKey | ZTNNOUKWHRIUID-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|