About Methyl 3-methyl-6-(oxan-2-yloxy)hexa-2,4-dienoate
Methyl 3-methyl-6-(oxan-2-yloxy)hexa-2,4-dienoate (PubChem CID 393293) has the molecular formula C13H20O4
and a molecular weight of 240.29 g/mol. Its IUPAC name is methyl 3-methyl-6-(oxan-2-yloxy)hexa-2,4-dienoate.
Molecular Properties
| Compound Name | Methyl 3-methyl-6-(oxan-2-yloxy)hexa-2,4-dienoate |
| PubChem CID | 393293 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | methyl 3-methyl-6-(oxan-2-yloxy)hexa-2,4-dienoate |
| SMILES | CC(=CC(=O)OC)C=CCOC1CCCCO1 |
| InChI | InChI=1S/C13H20O4/c1-11(10-12(14)15-2)6-5-9-17-13-7-3-4-8-16-13/h5-6,10,13H,3-4,7-9H2,1-2H3 |
| InChIKey | PAVIZGYIHARLFQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 44.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | 294 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze Methyl 3-methyl-6-(oxan-2-yloxy)hexa-2,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Methyl 3-methyl-6-(oxan-2-yloxy)hexa-2,4-dienoate?
The IUPAC name of Methyl 3-methyl-6-(oxan-2-yloxy)hexa-2,4-dienoate (CID 393293) is methyl 3-methyl-6-(oxan-2-yloxy)hexa-2,4-dienoate.
What is the SMILES notation for Methyl 3-methyl-6-(oxan-2-yloxy)hexa-2,4-dienoate?
The canonical SMILES for Methyl 3-methyl-6-(oxan-2-yloxy)hexa-2,4-dienoate is CC(=CC(=O)OC)C=CCOC1CCCCO1.
What is the InChIKey of Methyl 3-methyl-6-(oxan-2-yloxy)hexa-2,4-dienoate?
The InChIKey is PAVIZGYIHARLFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O4/c1-11(10-12(14)15-2)6-5-9-17-13-7-3-4-8-16-13/h5-6,10,13H,3-4,7-9H2,1-2H3.
What are the key properties of Methyl 3-methyl-6-(oxan-2-yloxy)hexa-2,4-dienoate?
Methyl 3-methyl-6-(oxan-2-yloxy)hexa-2,4-dienoate has a molecular weight of 240.29 g/mol, XLogP of 2.40, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Methyl 3-methyl-6-(oxan-2-yloxy)hexa-2,4-dienoate is sourced from PubChem (CID 393293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).