C20H23N5OS — CID 39332870
2-[ethyl-(12-ethyl-11-methyl-4-phenyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-yl)amino]ethanol (PubChem CID 39332870) has the molecular formula C20H23N5OS and a molecular weight of 381.51 g/mol. Its IUPAC name is 2-[ethyl-(12-ethyl-11-methyl-4-phenyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-yl)amino]ethanol.
| Compound Name | 2-[ethyl-(12-ethyl-11-methyl-4-phenyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-yl)amino]ethanol |
|---|---|
| PubChem CID | 39332870 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-[ethyl-(12-ethyl-11-methyl-4-phenyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-yl)amino]ethanol |
| SMILES | CCc1c(C)sc2nc(N(CC)CCO)n3nc(-c4ccccc4)nc3c12 |
| InChI | InChI=1S/C20H23N5OS/c1-4-15-13(3)27-19-16(15)18-21-17(14-9-7-6-8-10-14)23-25(18)20(22-19)24(5-2)11-12-26/h6-10,26H,4-5,11-12H2,1-3H3 |
| InChIKey | WSFHADXHMHUQMZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |