C23H26N2O8 — CID 3933620
(4-butoxy-2,3-dinitrophenyl) 3-(4-butoxyphenyl)prop-2-enoate (PubChem CID 3933620) has the molecular formula C23H26N2O8 and a molecular weight of 458.47 g/mol. Its IUPAC name is (4-butoxy-2,3-dinitrophenyl) 3-(4-butoxyphenyl)prop-2-enoate.
| Compound Name | (4-butoxy-2,3-dinitrophenyl) 3-(4-butoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3933620 |
| Molecular Formula | C23H26N2O8 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | (4-butoxy-2,3-dinitrophenyl) 3-(4-butoxyphenyl)prop-2-enoate |
| SMILES | CCCCOc1ccc(C=CC(=O)Oc2ccc(OCCCC)c([N+](=O)[O-])c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H26N2O8/c1-3-5-15-31-18-10-7-17(8-11-18)9-14-21(26)33-20-13-12-19(32-16-6-4-2)22(24(27)28)23(20)25(29)30/h7-14H,3-6,15-16H2,1-2H3 |
| InChIKey | BYOBVLZDCJVLCI-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 131.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|