About N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-(4-methylphenyl)sulfonylethenyl]formamide
N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-(4-methylphenyl)sulfonylethenyl]formamide (PubChem CID 39336770) has the molecular formula C22H17Cl2NO3S3
and a molecular weight of 510.49 g/mol. Its IUPAC name is N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-(4-methylphenyl)sulfonylethenyl]formamide.
Molecular Properties
| Compound Name | N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-(4-methylphenyl)sulfonylethenyl]formamide |
| PubChem CID | 39336770 |
| Molecular Formula | C22H17Cl2NO3S3 |
| Molecular Weight | 510.49 g/mol |
| Exact Mass | 508.97 |
| IUPAC Name | N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-(4-methylphenyl)sulfonylethenyl]formamide |
| SMILES | Cc1ccc(S(=O)(=O)C(NC=O)=C(Sc2ccc(Cl)cc2)Sc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H17Cl2NO3S3/c1-15-2-12-20(13-3-15)31(27,28)21(25-14-26)22(29-18-8-4-16(23)5-9-18)30-19-10-6-17(24)7-11-19/h2-14H,1H3,(H,25,26) |
| InChIKey | ADPYSQIWNGTXEY-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 510.49 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-(4-methylphenyl)sulfonylethenyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-(4-methylphenyl)sulfonylethenyl]formamide?
The IUPAC name of N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-(4-methylphenyl)sulfonylethenyl]formamide (CID 39336770) is N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-(4-methylphenyl)sulfonylethenyl]formamide.
What is the SMILES notation for N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-(4-methylphenyl)sulfonylethenyl]formamide?
The canonical SMILES for N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-(4-methylphenyl)sulfonylethenyl]formamide is Cc1ccc(S(=O)(=O)C(NC=O)=C(Sc2ccc(Cl)cc2)Sc2ccc(Cl)cc2)cc1.
What is the InChIKey of N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-(4-methylphenyl)sulfonylethenyl]formamide?
The InChIKey is ADPYSQIWNGTXEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17Cl2NO3S3/c1-15-2-12-20(13-3-15)31(27,28)21(25-14-26)22(29-18-8-4-16(23)5-9-18)30-19-10-6-17(24)7-11-19/h2-14H,1H3,(H,25,26).
What are the key properties of N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-(4-methylphenyl)sulfonylethenyl]formamide?
N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-(4-methylphenyl)sulfonylethenyl]formamide has a molecular weight of 510.49 g/mol, XLogP of 6.53, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-(4-methylphenyl)sulfonylethenyl]formamide is sourced from PubChem (CID 39336770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).