C15H15N5O2S — CID 39336833
2-[[4-(furan-2-yl)-11,12-dimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-yl]amino]ethanol (PubChem CID 39336833) has the molecular formula C15H15N5O2S and a molecular weight of 329.39 g/mol. Its IUPAC name is 2-[[4-(furan-2-yl)-11,12-dimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-yl]amino]ethanol.
| Compound Name | 2-[[4-(furan-2-yl)-11,12-dimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-yl]amino]ethanol |
|---|---|
| PubChem CID | 39336833 |
| Molecular Formula | C15H15N5O2S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-[[4-(furan-2-yl)-11,12-dimethyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-yl]amino]ethanol |
| SMILES | Cc1sc2nc(NCCO)n3nc(-c4ccco4)nc3c2c1C |
| InChI | InChI=1S/C15H15N5O2S/c1-8-9(2)23-14-11(8)13-17-12(10-4-3-7-22-10)19-20(13)15(18-14)16-5-6-21/h3-4,7,21H,5-6H2,1-2H3,(H,16,18) |
| InChIKey | IUIVFBSDVUOPFE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |