C24H27FN4O4 — CID 39338037
(3R)-1-(4-fluorophenyl)-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 39338037) has the molecular formula C24H27FN4O4 and a molecular weight of 454.50 g/mol. Its IUPAC name is (3R)-1-(4-fluorophenyl)-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(4-fluorophenyl)-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 39338037 |
| Molecular Formula | C24H27FN4O4 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | (3R)-1-(4-fluorophenyl)-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=O)CNC(=O)[C@@H]3CC(=O)N(c4ccc(F)cc4)C3)CC2)cc1 |
| InChI | InChI=1S/C24H27FN4O4/c1-33-21-8-6-19(7-9-21)27-10-12-28(13-11-27)23(31)15-26-24(32)17-14-22(30)29(16-17)20-4-2-18(25)3-5-20/h2-9,17H,10-16H2,1H3,(H,26,32)/t17-/m1/s1 |
| InChIKey | VNELUEAKHQYNFS-QGZVFWFLSA-N |
| XLogP | 1.65 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|