C15H24N6 — CID 39339122
3-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 39339122) has the molecular formula C15H24N6 and a molecular weight of 288.40 g/mol. Its IUPAC name is 3-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | 3-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 39339122 |
| Molecular Formula | C15H24N6 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 3-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | Cc1nnc2ccc(NC3CC(C)(C)NC(C)(C)C3)nn12 |
| InChI | InChI=1S/C15H24N6/c1-10-17-18-13-7-6-12(19-21(10)13)16-11-8-14(2,3)20-15(4,5)9-11/h6-7,11,20H,8-9H2,1-5H3,(H,16,19) |
| InChIKey | SHLUTQZDJGLVGD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 67.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |