About 4,6-diamino-2-thiophen-2-yl-2H-thiopyran-3,5-dicarbonitrile
4,6-diamino-2-thiophen-2-yl-2H-thiopyran-3,5-dicarbonitrile (PubChem CID 3933996) has the molecular formula C11H8N4S2
and a molecular weight of 260.35 g/mol. Its IUPAC name is 4,6-diamino-2-thiophen-2-yl-2H-thiopyran-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | 4,6-diamino-2-thiophen-2-yl-2H-thiopyran-3,5-dicarbonitrile |
| PubChem CID | 3933996 |
| Molecular Formula | C11H8N4S2 |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 4,6-diamino-2-thiophen-2-yl-2H-thiopyran-3,5-dicarbonitrile |
| SMILES | N#CC1=C(N)SC(c2cccs2)C(C#N)=C1N |
| InChI | InChI=1S/C11H8N4S2/c12-4-6-9(14)7(5-13)11(15)17-10(6)8-2-1-3-16-8/h1-3,10H,14-15H2 |
| InChIKey | MDPPLCCXCAEWCG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4,6-diamino-2-thiophen-2-yl-2H-thiopyran-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-diamino-2-thiophen-2-yl-2H-thiopyran-3,5-dicarbonitrile?
The IUPAC name of 4,6-diamino-2-thiophen-2-yl-2H-thiopyran-3,5-dicarbonitrile (CID 3933996) is 4,6-diamino-2-thiophen-2-yl-2H-thiopyran-3,5-dicarbonitrile.
What is the SMILES notation for 4,6-diamino-2-thiophen-2-yl-2H-thiopyran-3,5-dicarbonitrile?
The canonical SMILES for 4,6-diamino-2-thiophen-2-yl-2H-thiopyran-3,5-dicarbonitrile is N#CC1=C(N)SC(c2cccs2)C(C#N)=C1N.
What is the InChIKey of 4,6-diamino-2-thiophen-2-yl-2H-thiopyran-3,5-dicarbonitrile?
The InChIKey is MDPPLCCXCAEWCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4S2/c12-4-6-9(14)7(5-13)11(15)17-10(6)8-2-1-3-16-8/h1-3,10H,14-15H2.
What are the key properties of 4,6-diamino-2-thiophen-2-yl-2H-thiopyran-3,5-dicarbonitrile?
4,6-diamino-2-thiophen-2-yl-2H-thiopyran-3,5-dicarbonitrile has a molecular weight of 260.35 g/mol, XLogP of 1.97, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-diamino-2-thiophen-2-yl-2H-thiopyran-3,5-dicarbonitrile is sourced from PubChem (CID 3933996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).