C12H18N4O4S — CID 39341359
(2R)-5-(carbamoylamino)-2-[(2,4-dimethyl-1,3-thiazole-5-carbonyl)amino]pentanoic acid (PubChem CID 39341359) has the molecular formula C12H18N4O4S and a molecular weight of 314.37 g/mol. Its IUPAC name is (2R)-5-(carbamoylamino)-2-[(2,4-dimethyl-1,3-thiazole-5-carbonyl)amino]pentanoic acid.
| Compound Name | (2R)-5-(carbamoylamino)-2-[(2,4-dimethyl-1,3-thiazole-5-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 39341359 |
| Molecular Formula | C12H18N4O4S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (2R)-5-(carbamoylamino)-2-[(2,4-dimethyl-1,3-thiazole-5-carbonyl)amino]pentanoic acid |
| SMILES | Cc1nc(C)c(C(=O)N[C@H](CCCNC(N)=O)C(=O)O)s1 |
| InChI | InChI=1S/C12H18N4O4S/c1-6-9(21-7(2)15-6)10(17)16-8(11(18)19)4-3-5-14-12(13)20/h8H,3-5H2,1-2H3,(H,16,17)(H,18,19)(H3,13,14,20)/t8-/m1/s1 |
| InChIKey | YAMKNFSZLXCIML-MRVPVSSYSA-N |
| XLogP | 0.39 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|