C24H23N5OS — CID 39343125
12-(2-methylpropyl)-8-(2-phenylethyl)-4-pyridin-3-yl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one (PubChem CID 39343125) has the molecular formula C24H23N5OS and a molecular weight of 429.55 g/mol. Its IUPAC name is 12-(2-methylpropyl)-8-(2-phenylethyl)-4-pyridin-3-yl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one.
| Compound Name | 12-(2-methylpropyl)-8-(2-phenylethyl)-4-pyridin-3-yl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one |
|---|---|
| PubChem CID | 39343125 |
| Molecular Formula | C24H23N5OS |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 12-(2-methylpropyl)-8-(2-phenylethyl)-4-pyridin-3-yl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one |
| SMILES | CC(C)Cc1csc2c1c1nc(-c3cccnc3)nn1c(=O)n2CCc1ccccc1 |
| InChI | InChI=1S/C24H23N5OS/c1-16(2)13-19-15-31-23-20(19)22-26-21(18-9-6-11-25-14-18)27-29(22)24(30)28(23)12-10-17-7-4-3-5-8-17/h3-9,11,14-16H,10,12-13H2,1-2H3 |
| InChIKey | WDOYNXGDKQMMSS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 65.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |