About 4-[(2R)-oxiran-2-yl]-2,8-bis(trifluoromethyl)quinoline
4-[(2R)-oxiran-2-yl]-2,8-bis(trifluoromethyl)quinoline (PubChem CID 39345774) has the molecular formula C13H7F6NO
and a molecular weight of 307.19 g/mol. Its IUPAC name is 4-[(2R)-oxiran-2-yl]-2,8-bis(trifluoromethyl)quinoline.
Molecular Properties
| Compound Name | 4-[(2R)-oxiran-2-yl]-2,8-bis(trifluoromethyl)quinoline |
| PubChem CID | 39345774 |
| Molecular Formula | C13H7F6NO |
| Molecular Weight | 307.19 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 4-[(2R)-oxiran-2-yl]-2,8-bis(trifluoromethyl)quinoline |
| SMILES | FC(F)(F)c1cc([C@@H]2CO2)c2cccc(C(F)(F)F)c2n1 |
| InChI | InChI=1S/C13H7F6NO/c14-12(15,16)8-3-1-2-6-7(9-5-21-9)4-10(13(17,18)19)20-11(6)8/h1-4,9H,5H2/t9-/m0/s1 |
| InChIKey | ZRNRGGNAVKYDQA-VIFPVBQESA-N |
| XLogP | 4.34 |
| TPSA | 25.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.19 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2R)-oxiran-2-yl]-2,8-bis(trifluoromethyl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R)-oxiran-2-yl]-2,8-bis(trifluoromethyl)quinoline?
The IUPAC name of 4-[(2R)-oxiran-2-yl]-2,8-bis(trifluoromethyl)quinoline (CID 39345774) is 4-[(2R)-oxiran-2-yl]-2,8-bis(trifluoromethyl)quinoline.
What is the SMILES notation for 4-[(2R)-oxiran-2-yl]-2,8-bis(trifluoromethyl)quinoline?
The canonical SMILES for 4-[(2R)-oxiran-2-yl]-2,8-bis(trifluoromethyl)quinoline is FC(F)(F)c1cc([C@@H]2CO2)c2cccc(C(F)(F)F)c2n1.
What is the InChIKey of 4-[(2R)-oxiran-2-yl]-2,8-bis(trifluoromethyl)quinoline?
The InChIKey is ZRNRGGNAVKYDQA-VIFPVBQESA-N. The full InChI is InChI=1S/C13H7F6NO/c14-12(15,16)8-3-1-2-6-7(9-5-21-9)4-10(13(17,18)19)20-11(6)8/h1-4,9H,5H2/t9-/m0/s1.
What are the key properties of 4-[(2R)-oxiran-2-yl]-2,8-bis(trifluoromethyl)quinoline?
4-[(2R)-oxiran-2-yl]-2,8-bis(trifluoromethyl)quinoline has a molecular weight of 307.19 g/mol, XLogP of 4.34, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R)-oxiran-2-yl]-2,8-bis(trifluoromethyl)quinoline is sourced from PubChem (CID 39345774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).