C11H9Cl2N — CID 39346010
2,7-dichloro-3-ethylquinoline (PubChem CID 39346010) has the molecular formula C11H9Cl2N and a molecular weight of 226.11 g/mol. Its IUPAC name is 2,7-dichloro-3-ethylquinoline.
| Compound Name | 2,7-dichloro-3-ethylquinoline |
|---|---|
| PubChem CID | 39346010 |
| Molecular Formula | C11H9Cl2N |
| Molecular Weight | 226.11 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 2,7-dichloro-3-ethylquinoline |
| SMILES | CCc1cc2ccc(Cl)cc2nc1Cl |
| InChI | InChI=1S/C11H9Cl2N/c1-2-7-5-8-3-4-9(12)6-10(8)14-11(7)13/h3-6H,2H2,1H3 |
| InChIKey | CPMBFXPQWNYBMB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.11 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|