C18H15FN2O6S — CID 3935033
1-[3-(4-fluorophenoxy)-5-nitrophenyl]-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-b]pyrrol-2-one (PubChem CID 3935033) has the molecular formula C18H15FN2O6S and a molecular weight of 406.39 g/mol. Its IUPAC name is 1-[3-(4-fluorophenoxy)-5-nitrophenyl]-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-b]pyrrol-2-one.
| Compound Name | 1-[3-(4-fluorophenoxy)-5-nitrophenyl]-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-b]pyrrol-2-one |
|---|---|
| PubChem CID | 3935033 |
| Molecular Formula | C18H15FN2O6S |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 1-[3-(4-fluorophenoxy)-5-nitrophenyl]-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-b]pyrrol-2-one |
| SMILES | O=C1CC2CS(=O)(=O)CC2N1c1cc(Oc2ccc(F)cc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H15FN2O6S/c19-12-1-3-15(4-2-12)27-16-7-13(6-14(8-16)21(23)24)20-17-10-28(25,26)9-11(17)5-18(20)22/h1-4,6-8,11,17H,5,9-10H2 |
| InChIKey | XWVBLRRMMCHTJB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|