C19H21N5OS — CID 39350984
2-[(11,12-dimethyl-4-phenyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-yl)-ethylamino]ethanol (PubChem CID 39350984) has the molecular formula C19H21N5OS and a molecular weight of 367.48 g/mol. Its IUPAC name is 2-[(11,12-dimethyl-4-phenyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-yl)-ethylamino]ethanol.
| Compound Name | 2-[(11,12-dimethyl-4-phenyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-yl)-ethylamino]ethanol |
|---|---|
| PubChem CID | 39350984 |
| Molecular Formula | C19H21N5OS |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-[(11,12-dimethyl-4-phenyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-yl)-ethylamino]ethanol |
| SMILES | CCN(CCO)c1nc2sc(C)c(C)c2c2nc(-c3ccccc3)nn12 |
| InChI | InChI=1S/C19H21N5OS/c1-4-23(10-11-25)19-21-18-15(12(2)13(3)26-18)17-20-16(22-24(17)19)14-8-6-5-7-9-14/h5-9,25H,4,10-11H2,1-3H3 |
| InChIKey | QZLPIFINUCKUEA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |