C23H19FN4OS — CID 39351517
12-ethyl-8-[(4-fluorophenyl)methyl]-11-methyl-4-phenyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one (PubChem CID 39351517) has the molecular formula C23H19FN4OS and a molecular weight of 418.50 g/mol. Its IUPAC name is 12-ethyl-8-[(4-fluorophenyl)methyl]-11-methyl-4-phenyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one.
| Compound Name | 12-ethyl-8-[(4-fluorophenyl)methyl]-11-methyl-4-phenyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one |
|---|---|
| PubChem CID | 39351517 |
| Molecular Formula | C23H19FN4OS |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 12-ethyl-8-[(4-fluorophenyl)methyl]-11-methyl-4-phenyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one |
| SMILES | CCc1c(C)sc2c1c1nc(-c3ccccc3)nn1c(=O)n2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C23H19FN4OS/c1-3-18-14(2)30-22-19(18)21-25-20(16-7-5-4-6-8-16)26-28(21)23(29)27(22)13-15-9-11-17(24)12-10-15/h4-12H,3,13H2,1-2H3 |
| InChIKey | DLLVVLOLNCYORF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |