C18H21N5O2 — CID 39351756
N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N'-(1H-indol-4-yl)oxamide (PubChem CID 39351756) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N'-(1H-indol-4-yl)oxamide.
| Compound Name | N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N'-(1H-indol-4-yl)oxamide |
|---|---|
| PubChem CID | 39351756 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N'-(1H-indol-4-yl)oxamide |
| SMILES | CCn1nc(C)c(CNC(=O)C(=O)Nc2cccc3[nH]ccc23)c1C |
| InChI | InChI=1S/C18H21N5O2/c1-4-23-12(3)14(11(2)22-23)10-20-17(24)18(25)21-16-7-5-6-15-13(16)8-9-19-15/h5-9,19H,4,10H2,1-3H3,(H,20,24)(H,21,25) |
| InChIKey | RNAPTBRQJKWWCR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|