About 6-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-3-(4-fluorophenyl)-1,2-benzoxazole
6-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-3-(4-fluorophenyl)-1,2-benzoxazole (PubChem CID 39352056) has the molecular formula C22H15ClFNO4
and a molecular weight of 411.82 g/mol. Its IUPAC name is 6-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-3-(4-fluorophenyl)-1,2-benzoxazole.
Molecular Properties
| Compound Name | 6-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-3-(4-fluorophenyl)-1,2-benzoxazole |
| PubChem CID | 39352056 |
| Molecular Formula | C22H15ClFNO4 |
| Molecular Weight | 411.82 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 6-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-3-(4-fluorophenyl)-1,2-benzoxazole |
| SMILES | Fc1ccc(-c2noc3cc(OCc4cc(Cl)cc5c4OCOC5)ccc23)cc1 |
| InChI | InChI=1S/C22H15ClFNO4/c23-16-7-14-10-26-12-28-22(14)15(8-16)11-27-18-5-6-19-20(9-18)29-25-21(19)13-1-3-17(24)4-2-13/h1-9H,10-12H2 |
| InChIKey | HFJHYYWKEQVTSV-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 53.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.82 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-3-(4-fluorophenyl)-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-3-(4-fluorophenyl)-1,2-benzoxazole?
The IUPAC name of 6-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-3-(4-fluorophenyl)-1,2-benzoxazole (CID 39352056) is 6-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-3-(4-fluorophenyl)-1,2-benzoxazole.
What is the SMILES notation for 6-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-3-(4-fluorophenyl)-1,2-benzoxazole?
The canonical SMILES for 6-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-3-(4-fluorophenyl)-1,2-benzoxazole is Fc1ccc(-c2noc3cc(OCc4cc(Cl)cc5c4OCOC5)ccc23)cc1.
What is the InChIKey of 6-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-3-(4-fluorophenyl)-1,2-benzoxazole?
The InChIKey is HFJHYYWKEQVTSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15ClFNO4/c23-16-7-14-10-26-12-28-22(14)15(8-16)11-27-18-5-6-19-20(9-18)29-25-21(19)13-1-3-17(24)4-2-13/h1-9H,10-12H2.
What are the key properties of 6-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-3-(4-fluorophenyl)-1,2-benzoxazole?
6-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-3-(4-fluorophenyl)-1,2-benzoxazole has a molecular weight of 411.82 g/mol, XLogP of 5.73, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-3-(4-fluorophenyl)-1,2-benzoxazole is sourced from PubChem (CID 39352056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).