C10H13Cl2NO2 — CID 39352654
(2R)-1-(3,5-dichlorophenoxy)-3-(methylamino)propan-2-ol (PubChem CID 39352654) has the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. Its IUPAC name is (2R)-1-(3,5-dichlorophenoxy)-3-(methylamino)propan-2-ol.
| Compound Name | (2R)-1-(3,5-dichlorophenoxy)-3-(methylamino)propan-2-ol |
|---|---|
| PubChem CID | 39352654 |
| Molecular Formula | C10H13Cl2NO2 |
| Molecular Weight | 250.12 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | (2R)-1-(3,5-dichlorophenoxy)-3-(methylamino)propan-2-ol |
| SMILES | CNC[C@@H](O)COc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H13Cl2NO2/c1-13-5-9(14)6-15-10-3-7(11)2-8(12)4-10/h2-4,9,13-14H,5-6H2,1H3/t9-/m1/s1 |
| InChIKey | XVUQUTDOVKEXAH-SECBINFHSA-N |
| XLogP | 1.95 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.12 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |