About N'-[(Z)-benzylideneamino]-N-(1,3-thiazol-2-yl)oxamide
N'-[(Z)-benzylideneamino]-N-(1,3-thiazol-2-yl)oxamide (PubChem CID 39353137) has the molecular formula C12H10N4O2S
and a molecular weight of 274.31 g/mol. Its IUPAC name is N'-[(Z)-benzylideneamino]-N-(1,3-thiazol-2-yl)oxamide.
Molecular Properties
| Compound Name | N'-[(Z)-benzylideneamino]-N-(1,3-thiazol-2-yl)oxamide |
| PubChem CID | 39353137 |
| Molecular Formula | C12H10N4O2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | N'-[(Z)-benzylideneamino]-N-(1,3-thiazol-2-yl)oxamide |
| SMILES | O=C(N/N=C\c1ccccc1)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C12H10N4O2S/c17-10(15-12-13-6-7-19-12)11(18)16-14-8-9-4-2-1-3-5-9/h1-8H,(H,16,18)(H,13,15,17)/b14-8- |
| InChIKey | PRRBVPCOCQUWNI-ZSOIEALJSA-N |
| XLogP | 1.23 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[(Z)-benzylideneamino]-N-(1,3-thiazol-2-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(Z)-benzylideneamino]-N-(1,3-thiazol-2-yl)oxamide?
The IUPAC name of N'-[(Z)-benzylideneamino]-N-(1,3-thiazol-2-yl)oxamide (CID 39353137) is N'-[(Z)-benzylideneamino]-N-(1,3-thiazol-2-yl)oxamide.
What is the SMILES notation for N'-[(Z)-benzylideneamino]-N-(1,3-thiazol-2-yl)oxamide?
The canonical SMILES for N'-[(Z)-benzylideneamino]-N-(1,3-thiazol-2-yl)oxamide is O=C(N/N=C\c1ccccc1)C(=O)Nc1nccs1.
What is the InChIKey of N'-[(Z)-benzylideneamino]-N-(1,3-thiazol-2-yl)oxamide?
The InChIKey is PRRBVPCOCQUWNI-ZSOIEALJSA-N. The full InChI is InChI=1S/C12H10N4O2S/c17-10(15-12-13-6-7-19-12)11(18)16-14-8-9-4-2-1-3-5-9/h1-8H,(H,16,18)(H,13,15,17)/b14-8-.
What are the key properties of N'-[(Z)-benzylideneamino]-N-(1,3-thiazol-2-yl)oxamide?
N'-[(Z)-benzylideneamino]-N-(1,3-thiazol-2-yl)oxamide has a molecular weight of 274.31 g/mol, XLogP of 1.23, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(Z)-benzylideneamino]-N-(1,3-thiazol-2-yl)oxamide is sourced from PubChem (CID 39353137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).